C20H34O — CID 123238971
[(1S,4R,9R,10S,13S)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanol (PubChem CID 123238971) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is [(1S,4R,9R,10S,13S)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanol.
| Compound Name | [(1S,4R,9R,10S,13S)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanol |
|---|---|
| PubChem CID | 123238971 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | [(1S,4R,9R,10S,13S)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanol |
| SMILES | CC1(CO)CCC[C@@]2(C)[C@H]1CC[C@@]13CC[C@](C)(CC[C@@H]12)C3 |
| InChI | InChI=1S/C20H34O/c1-17-9-5-16-19(3)8-4-7-18(2,14-21)15(19)6-10-20(16,13-17)12-11-17/h15-16,21H,4-14H2,1-3H3/t15-,16+,17-,18?,19-,20-/m0/s1 |
| InChIKey | RLWRLVVSEHTLRR-HAGSAPIOSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |