C42H68O5 — CID 167648672
2-oxo-2-[[(1S,5R,9S,13R)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy]acetic acid;[(1S,5R,9S,13R)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanol (PubChem CID 167648672) has the molecular formula C42H68O5 and a molecular weight of 653.00 g/mol. Its IUPAC name is 2-oxo-2-[[(1S,5R,9S,13R)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy]acetic acid;[(1S,5R,9S,13R)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanol.
| Compound Name | 2-oxo-2-[[(1S,5R,9S,13R)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy]acetic acid;[(1S,5R,9S,13R)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanol |
|---|---|
| PubChem CID | 167648672 |
| Molecular Formula | C42H68O5 |
| Molecular Weight | 653.00 g/mol |
| Exact Mass | 652.51 |
| IUPAC Name | 2-oxo-2-[[(1S,5R,9S,13R)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy]acetic acid;[(1S,5R,9S,13R)-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methanol |
| SMILES | C[C@@]12CCC3[C@@](CCC4[C@](C)(CO)CCC[C@]43C)(CC1)C2.C[C@@]12CCC3[C@@](CCC4[C@](C)(COC(=O)C(=O)O)CCC[C@]43C)(CC1)C2 |
| InChI | InChI=1S/C22H34O4.C20H34O/c1-19-9-5-16-21(3)8-4-7-20(2,14-26-18(25)17(23)24)15(21)6-10-22(16,13-19)12-11-19;1-17-9-5-16-19(3)8-4-7-18(2,14-21)15(19)6-10-20(16,13-17)12-11-17/h15-16H,4-14H2,1-3H3,(H,23,24);15-16,21H,4-14H2,1-3H3/t15?,16?,19-,20+,21-,22+;15?,16?,17-,18+,19-,20+/m11/s1 |
| InChIKey | QGHCKMSCQDEQBP-PHFZPBGKSA-N |
| XLogP | 9.98 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.00 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|