C20H32O2 — CID 162937376
(1S,2S,4S,5S,9R,10S,13S)-5-(hydroxymethyl)-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-en-2-ol (PubChem CID 162937376) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,2S,4S,5S,9R,10S,13S)-5-(hydroxymethyl)-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-en-2-ol.
| Compound Name | (1S,2S,4S,5S,9R,10S,13S)-5-(hydroxymethyl)-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-en-2-ol |
|---|---|
| PubChem CID | 162937376 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,2S,4S,5S,9R,10S,13S)-5-(hydroxymethyl)-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-en-2-ol |
| SMILES | C[C@@]12C=C[C@]3(C1)[C@@H](O)C[C@@H]1[C@@](C)(CO)CCC[C@@]1(C)[C@@H]3CC2 |
| InChI | InChI=1S/C20H32O2/c1-17-8-5-14-19(3)7-4-6-18(2,13-21)15(19)11-16(22)20(14,12-17)10-9-17/h9-10,14-16,21-22H,4-8,11-13H2,1-3H3/t14-,15+,16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | JKJYSQIOZWPLOF-XUBFPOGISA-N |
| XLogP | 3.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|