C20H30O4 — CID 10759166
(6R,9R,16S)-6,16-dihydroxy-16-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadec-13-en-11-one (PubChem CID 10759166) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (6R,9R,16S)-6,16-dihydroxy-16-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadec-13-en-11-one.
| Compound Name | (6R,9R,16S)-6,16-dihydroxy-16-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadec-13-en-11-one |
|---|---|
| PubChem CID | 10759166 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (6R,9R,16S)-6,16-dihydroxy-16-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadec-13-en-11-one |
| SMILES | CC1(C)C2CCC34C=CC(C(=O)C3[C@]2(C)CC[C@H]1O)[C@](O)(CO)C4 |
| InChI | InChI=1S/C20H30O4/c1-17(2)13-5-9-19-8-4-12(20(24,10-19)11-21)15(23)16(19)18(13,3)7-6-14(17)22/h4,8,12-14,16,21-22,24H,5-7,9-11H2,1-3H3/t12?,13?,14-,16?,18-,19?,20-/m1/s1 |
| InChIKey | OVFTZWDNXFNROM-LIRRZOLJSA-N |
| XLogP | 2.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|