C15H22O2 — CID 163041493
5-hydroxy-2,6,6-trimethyl-9-methylidenetricyclo[5.4.0.02,8]undecan-10-one (PubChem CID 163041493) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 5-hydroxy-2,6,6-trimethyl-9-methylidenetricyclo[5.4.0.02,8]undecan-10-one.
| Compound Name | 5-hydroxy-2,6,6-trimethyl-9-methylidenetricyclo[5.4.0.02,8]undecan-10-one |
|---|---|
| PubChem CID | 163041493 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 5-hydroxy-2,6,6-trimethyl-9-methylidenetricyclo[5.4.0.02,8]undecan-10-one |
| SMILES | C=C1C(=O)CC2C3C1C2(C)CCC(O)C3(C)C |
| InChI | InChI=1S/C15H22O2/c1-8-10(16)7-9-13-12(8)15(9,4)6-5-11(17)14(13,2)3/h9,11-13,17H,1,5-7H2,2-4H3 |
| InChIKey | GGIHRTVEXPCZNG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|