C20H30O2 — CID 162996742
7-hydroxy-4a,8,8-trimethyl-3-methylidene-4-(3-methylpenta-2,4-dienyl)-1,4,5,6,7,8a-hexahydronaphthalen-2-one (PubChem CID 162996742) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 7-hydroxy-4a,8,8-trimethyl-3-methylidene-4-(3-methylpenta-2,4-dienyl)-1,4,5,6,7,8a-hexahydronaphthalen-2-one.
| Compound Name | 7-hydroxy-4a,8,8-trimethyl-3-methylidene-4-(3-methylpenta-2,4-dienyl)-1,4,5,6,7,8a-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 162996742 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 7-hydroxy-4a,8,8-trimethyl-3-methylidene-4-(3-methylpenta-2,4-dienyl)-1,4,5,6,7,8a-hexahydronaphthalen-2-one |
| SMILES | C=CC(C)=CCC1C(=C)C(=O)CC2C(C)(C)C(O)CCC12C |
| InChI | InChI=1S/C20H30O2/c1-7-13(2)8-9-15-14(3)16(21)12-17-19(4,5)18(22)10-11-20(15,17)6/h7-8,15,17-18,22H,1,3,9-12H2,2,4-6H3 |
| InChIKey | HLOCMMHCYCJIHS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|