C8H8Br2O — CID 101389894
(1S,4R,5S,8R)-4,8-dibromo-9-oxabicyclo[3.3.1]nona-2,6-diene (PubChem CID 101389894) has the molecular formula C8H8Br2O and a molecular weight of 279.96 g/mol. Its IUPAC name is (1S,4R,5S,8R)-4,8-dibromo-9-oxabicyclo[3.3.1]nona-2,6-diene.
| Compound Name | (1S,4R,5S,8R)-4,8-dibromo-9-oxabicyclo[3.3.1]nona-2,6-diene |
|---|---|
| PubChem CID | 101389894 |
| Molecular Formula | C8H8Br2O |
| Molecular Weight | 279.96 g/mol |
| Exact Mass | 277.89 |
| IUPAC Name | (1S,4R,5S,8R)-4,8-dibromo-9-oxabicyclo[3.3.1]nona-2,6-diene |
| SMILES | Br[C@@H]1C=C[C@@H]2O[C@H]1C=C[C@H]2Br |
| InChI | InChI=1S/C8H8Br2O/c9-5-1-3-7-6(10)2-4-8(5)11-7/h1-8H/t5-,6-,7+,8+/m1/s1 |
| InChIKey | JPVRZTDVOMKITN-NGJRWZKOSA-N |
| XLogP | 2.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.96 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|