C6H6O2 — CID 119057412
(1R,7S)-4,8-dioxabicyclo[5.1.0]octa-2,5-diene (PubChem CID 119057412) has the molecular formula C6H6O2 and a molecular weight of 110.11 g/mol. Its IUPAC name is (1R,7S)-4,8-dioxabicyclo[5.1.0]octa-2,5-diene.
| Compound Name | (1R,7S)-4,8-dioxabicyclo[5.1.0]octa-2,5-diene |
|---|---|
| PubChem CID | 119057412 |
| Molecular Formula | C6H6O2 |
| Molecular Weight | 110.11 g/mol |
| Exact Mass | 110.04 |
| IUPAC Name | (1R,7S)-4,8-dioxabicyclo[5.1.0]octa-2,5-diene |
| SMILES | C1=C[C@@H]2O[C@@H]2C=CO1 |
| InChI | InChI=1S/C6H6O2/c1-3-7-4-2-6-5(1)8-6/h1-6H/t5-,6+ |
| InChIKey | AYOXANKVWRPSRJ-OLQVQODUSA-N |
| XLogP | 0.81 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.11 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|