C11H12O2 — CID 162407196
(2S,4R,7S,9R)-3,8-dioxatetracyclo[8.2.1.02,9.04,7]trideca-5,11-diene (PubChem CID 162407196) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (2S,4R,7S,9R)-3,8-dioxatetracyclo[8.2.1.02,9.04,7]trideca-5,11-diene.
| Compound Name | (2S,4R,7S,9R)-3,8-dioxatetracyclo[8.2.1.02,9.04,7]trideca-5,11-diene |
|---|---|
| PubChem CID | 162407196 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2S,4R,7S,9R)-3,8-dioxatetracyclo[8.2.1.02,9.04,7]trideca-5,11-diene |
| SMILES | C1=CC2CC1[C@H]1O[C@H]3C=C[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C11H12O2/c1-2-7-5-6(1)10-11(7)13-9-4-3-8(9)12-10/h1-4,6-11H,5H2/t6?,7?,8-,9+,10+,11- |
| InChIKey | RYSJKBBCHFHBRG-QSRWHQBBSA-N |
| XLogP | 1.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|