C7H8S3 — CID 3034346
(1R,2S,6R,7S)-3,4,5-trithiatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 3034346) has the molecular formula C7H8S3 and a molecular weight of 188.34 g/mol. Its IUPAC name is (1R,2S,6R,7S)-3,4,5-trithiatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1R,2S,6R,7S)-3,4,5-trithiatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 3034346 |
| Molecular Formula | C7H8S3 |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | (1R,2S,6R,7S)-3,4,5-trithiatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | C1=C[C@H]2C[C@@H]1[C@H]1SSS[C@H]12 |
| InChI | InChI=1S/C7H8S3/c1-2-5-3-4(1)6-7(5)9-10-8-6/h1-2,4-7H,3H2/t4-,5+,6-,7+ |
| InChIKey | GFIOREJKLBPVEB-UMRXKNAASA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|