C8H10S2 — CID 135297883
3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 135297883) has the molecular formula C8H10S2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 135297883 |
| Molecular Formula | C8H10S2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | C1=CC2CC1C1SCSC21 |
| InChI | InChI=1S/C8H10S2/c1-2-6-3-5(1)7-8(6)10-4-9-7/h1-2,5-8H,3-4H2 |
| InChIKey | FASQYFINISNCBU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|