About 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene
3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 135297883) has the molecular formula C8H10S2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene.
Molecular Properties
| Compound Name | 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene |
| PubChem CID | 135297883 |
| Molecular Formula | C8H10S2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | C1=CC2CC1C1SCSC21 |
| InChI | InChI=1S/C8H10S2/c1-2-6-3-5(1)7-8(6)10-4-9-7/h1-2,5-8H,3-4H2 |
| InChIKey | FASQYFINISNCBU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene?
The IUPAC name of 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene (CID 135297883) is 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene.
What is the SMILES notation for 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene?
The canonical SMILES for 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene is C1=CC2CC1C1SCSC21.
What is the InChIKey of 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene?
The InChIKey is FASQYFINISNCBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S2/c1-2-6-3-5(1)7-8(6)10-4-9-7/h1-2,5-8H,3-4H2.
What are the key properties of 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene?
3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene has a molecular weight of 170.30 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene is sourced from PubChem (CID 135297883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).