C9H12S2 — CID 576303
spiro[1,3-dithiolane-2,5'-bicyclo[2.2.1]hept-2-ene] (PubChem CID 576303) has the molecular formula C9H12S2 and a molecular weight of 184.33 g/mol. Its IUPAC name is spiro[1,3-dithiolane-2,5'-bicyclo[2.2.1]hept-2-ene].
| Compound Name | spiro[1,3-dithiolane-2,5'-bicyclo[2.2.1]hept-2-ene] |
|---|---|
| PubChem CID | 576303 |
| Molecular Formula | C9H12S2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | spiro[1,3-dithiolane-2,5'-bicyclo[2.2.1]hept-2-ene] |
| SMILES | C1=CC2CC1CC21SCCS1 |
| InChI | InChI=1S/C9H12S2/c1-2-8-5-7(1)6-9(8)10-3-4-11-9/h1-2,7-8H,3-6H2 |
| InChIKey | OFHRBHZTLXDVJR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|