C8H8F2S2 — CID 20873011
4,4-difluoro-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 20873011) has the molecular formula C8H8F2S2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 4,4-difluoro-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | 4,4-difluoro-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 20873011 |
| Molecular Formula | C8H8F2S2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 4,4-difluoro-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | FC1(F)SC2C3C=CC(C3)C2S1 |
| InChI | InChI=1S/C8H8F2S2/c9-8(10)11-6-4-1-2-5(3-4)7(6)12-8/h1-2,4-7H,3H2 |
| InChIKey | USVAOECYYUSXOL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|