C8H8S3 — CID 20873012
3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene-4-thione (PubChem CID 20873012) has the molecular formula C8H8S3 and a molecular weight of 200.35 g/mol. Its IUPAC name is 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene-4-thione.
| Compound Name | 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene-4-thione |
|---|---|
| PubChem CID | 20873012 |
| Molecular Formula | C8H8S3 |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene-4-thione |
| SMILES | S=C1SC2C3C=CC(C3)C2S1 |
| InChI | InChI=1S/C8H8S3/c9-8-10-6-4-1-2-5(3-4)7(6)11-8/h1-2,4-7H,3H2 |
| InChIKey | IHNJTMDDTTWUSB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|