C15H18O4 — CID 20789736
5',5'-dimethylspiro[11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,4'-oxolane]-2'-one (PubChem CID 20789736) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is 5',5'-dimethylspiro[11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,4'-oxolane]-2'-one.
| Compound Name | 5',5'-dimethylspiro[11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,4'-oxolane]-2'-one |
|---|---|
| PubChem CID | 20789736 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 5',5'-dimethylspiro[11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,4'-oxolane]-2'-one |
| SMILES | CC1(C)OC(=O)CC12CC1OC2C2C3C=CC(O3)C12 |
| InChI | InChI=1S/C15H18O4/c1-14(2)15(6-10(16)19-14)5-9-11-7-3-4-8(17-7)12(11)13(15)18-9/h3-4,7-9,11-13H,5-6H2,1-2H3 |
| InChIKey | SDHNKCVPKHOYMR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|