C18H28O5Si — CID 166448822
(2R,4S,5S,6R)-5,9,10,10-tetramethyl-9-trimethylsilyloxy-3,11-dioxatetracyclo[4.4.3.01,6.02,4]tridecane-8,12-dione (PubChem CID 166448822) has the molecular formula C18H28O5Si and a molecular weight of 352.50 g/mol. Its IUPAC name is (2R,4S,5S,6R)-5,9,10,10-tetramethyl-9-trimethylsilyloxy-3,11-dioxatetracyclo[4.4.3.01,6.02,4]tridecane-8,12-dione.
| Compound Name | (2R,4S,5S,6R)-5,9,10,10-tetramethyl-9-trimethylsilyloxy-3,11-dioxatetracyclo[4.4.3.01,6.02,4]tridecane-8,12-dione |
|---|---|
| PubChem CID | 166448822 |
| Molecular Formula | C18H28O5Si |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (2R,4S,5S,6R)-5,9,10,10-tetramethyl-9-trimethylsilyloxy-3,11-dioxatetracyclo[4.4.3.01,6.02,4]tridecane-8,12-dione |
| SMILES | C[C@@H]1[C@@H]2OC2C23OC(=O)C[C@]12CC(=O)C(C)(O[Si](C)(C)C)C3(C)C |
| InChI | InChI=1S/C18H28O5Si/c1-10-13-14(21-13)18-15(2,3)16(4,23-24(5,6)7)11(19)8-17(10,18)9-12(20)22-18/h10,13-14H,8-9H2,1-7H3/t10-,13+,14?,16?,17-,18?/m1/s1 |
| InChIKey | QSZLHCCEQNDRJA-GLECVFSGSA-N |
| XLogP | 2.68 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|