C17H26O2 — CID 7123511
(4S)-4-methyl-4-(3,5,7-trimethyl-1-adamantyl)oxetan-2-one (PubChem CID 7123511) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (4S)-4-methyl-4-(3,5,7-trimethyl-1-adamantyl)oxetan-2-one.
| Compound Name | (4S)-4-methyl-4-(3,5,7-trimethyl-1-adamantyl)oxetan-2-one |
|---|---|
| PubChem CID | 7123511 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (4S)-4-methyl-4-(3,5,7-trimethyl-1-adamantyl)oxetan-2-one |
| SMILES | CC12CC3(C)CC(C)(C1)CC([C@]1(C)CC(=O)O1)(C2)C3 |
| InChI | InChI=1S/C17H26O2/c1-13-6-14(2)8-15(3,7-13)11-17(9-13,10-14)16(4)5-12(18)19-16/h5-11H2,1-4H3/t13?,14?,15?,16-,17?/m0/s1 |
| InChIKey | ATOWJNHOSGTWPS-KLZNEWFBSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|