C7H8O3 — CID 98524070
(1S,5S)-1,5-dimethyl-3-oxabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 98524070) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is (1S,5S)-1,5-dimethyl-3-oxabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | (1S,5S)-1,5-dimethyl-3-oxabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 98524070 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | (1S,5S)-1,5-dimethyl-3-oxabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | C[C@]12C[C@]1(C)C(=O)OC2=O |
| InChI | InChI=1S/C7H8O3/c1-6-3-7(6,2)5(9)10-4(6)8/h3H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | BMUKYPDUFGPXEL-RNFRBKRXSA-N |
| XLogP | 0.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|