C6H3F5O3 — CID 165100383
3,3,4,4,5-pentafluoro-5-methyloxane-2,6-dione (PubChem CID 165100383) has the molecular formula C6H3F5O3 and a molecular weight of 218.08 g/mol. Its IUPAC name is 3,3,4,4,5-pentafluoro-5-methyloxane-2,6-dione.
| Compound Name | 3,3,4,4,5-pentafluoro-5-methyloxane-2,6-dione |
|---|---|
| PubChem CID | 165100383 |
| Molecular Formula | C6H3F5O3 |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 3,3,4,4,5-pentafluoro-5-methyloxane-2,6-dione |
| SMILES | CC1(F)C(=O)OC(=O)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H3F5O3/c1-4(7)2(12)14-3(13)5(8,9)6(4,10)11/h1H3 |
| InChIKey | BESSWRKOFVKSBY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|