C9H2F4O5 — CID 122647230
1,2,6,7-tetrafluoro-4-oxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 122647230) has the molecular formula C9H2F4O5 and a molecular weight of 266.10 g/mol. Its IUPAC name is 1,2,6,7-tetrafluoro-4-oxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 1,2,6,7-tetrafluoro-4-oxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 122647230 |
| Molecular Formula | C9H2F4O5 |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 1,2,6,7-tetrafluoro-4-oxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | O=C1CC(=O)C2(F)C1(F)C1(F)C(=O)OC(=O)C21F |
| InChI | InChI=1S/C9H2F4O5/c10-6-2(14)1-3(15)7(6,11)9(13)5(17)18-4(16)8(6,9)12/h1H2 |
| InChIKey | WMTRJRQIXQMMSJ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|