About 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione
1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione (PubChem CID 535012) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione.
Analyze 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione?
The IUPAC name of 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione (CID 535012) is 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione.
What is the SMILES notation for 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione?
The canonical SMILES for 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione is CC12CC1(C)C(=O)C1(C)CC1(C)C2=O.
What is the InChIKey of 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione?
The InChIKey is BQPCLLPLCLJTSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-9-5-10(9,2)8(14)12(4)6-11(12,3)7(9)13/h5-6H2,1-4H3.
What are the key properties of 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione?
1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione has a molecular weight of 192.26 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5,7-tetramethyltricyclo[5.1.0.03,5]octane-2,6-dione is sourced from PubChem (CID 535012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).