C10H18N2O+2 — CID 3346078
5,7-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 3346078) has the molecular formula C10H18N2O+2 and a molecular weight of 182.27 g/mol. Its IUPAC name is 5,7-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 5,7-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 3346078 |
| Molecular Formula | C10H18N2O+2 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 5,7-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CC12C[NH+]3C[NH+](C1)CC(C)(C3)C2=O |
| InChI | InChI=1S/C10H16N2O/c1-9-3-11-5-10(2,8(9)13)6-12(4-9)7-11/h3-7H2,1-2H3/p+2 |
| InChIKey | XGTRHKDYLMRKHW-UHFFFAOYSA-P |
| XLogP | -2.66 |
| TPSA | 25.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |