C9H16N2O+2 — CID 7039196
5-methyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 7039196) has the molecular formula C9H16N2O+2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 5-methyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 5-methyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 7039196 |
| Molecular Formula | C9H16N2O+2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 5-methyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CC12C[NH+]3CC(C[NH+](C3)C1)C2=O |
| InChI | InChI=1S/C9H14N2O/c1-9-4-10-2-7(8(9)12)3-11(5-9)6-10/h7H,2-6H2,1H3/p+2 |
| InChIKey | YDUCEQRBZCUYSF-UHFFFAOYSA-P |
| XLogP | -3.05 |
| TPSA | 25.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |