C10H16O2 — CID 20686650
2,4,4,5,5-pentamethylcyclopentane-1,3-dione (PubChem CID 20686650) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2,4,4,5,5-pentamethylcyclopentane-1,3-dione.
| Compound Name | 2,4,4,5,5-pentamethylcyclopentane-1,3-dione |
|---|---|
| PubChem CID | 20686650 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2,4,4,5,5-pentamethylcyclopentane-1,3-dione |
| SMILES | CC1C(=O)C(C)(C)C(C)(C)C1=O |
| InChI | InChI=1S/C10H16O2/c1-6-7(11)9(2,3)10(4,5)8(6)12/h6H,1-5H3 |
| InChIKey | CTWMMEOFIRFOLM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|