C10H14O2 — CID 135170604
2,2,6-trimethyl-5-methylidenecyclohexane-1,4-dione (PubChem CID 135170604) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,2,6-trimethyl-5-methylidenecyclohexane-1,4-dione.
| Compound Name | 2,2,6-trimethyl-5-methylidenecyclohexane-1,4-dione |
|---|---|
| PubChem CID | 135170604 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2,2,6-trimethyl-5-methylidenecyclohexane-1,4-dione |
| SMILES | C=C1C(=O)CC(C)(C)C(=O)C1C |
| InChI | InChI=1S/C10H14O2/c1-6-7(2)9(12)10(3,4)5-8(6)11/h7H,1,5H2,2-4H3 |
| InChIKey | NBISELCVRDMWKU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|