C14H24O2 — CID 90110323
3,3,4,4,5,5,6,6-octamethylcyclohexane-1,2-dione (PubChem CID 90110323) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octamethylcyclohexane-1,2-dione.
| Compound Name | 3,3,4,4,5,5,6,6-octamethylcyclohexane-1,2-dione |
|---|---|
| PubChem CID | 90110323 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octamethylcyclohexane-1,2-dione |
| SMILES | CC1(C)C(=O)C(=O)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C14H24O2/c1-11(2)9(15)10(16)12(3,4)14(7,8)13(11,5)6/h1-8H3 |
| InChIKey | PPNAJSKNMDCHAO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|