C12H18O3 — CID 140639927
4,4,5,5,6,6-hexamethylcyclohexane-1,2,3-trione (PubChem CID 140639927) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexamethylcyclohexane-1,2,3-trione.
| Compound Name | 4,4,5,5,6,6-hexamethylcyclohexane-1,2,3-trione |
|---|---|
| PubChem CID | 140639927 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4,4,5,5,6,6-hexamethylcyclohexane-1,2,3-trione |
| SMILES | CC1(C)C(=O)C(=O)C(=O)C(C)(C)C1(C)C |
| InChI | InChI=1S/C12H18O3/c1-10(2)8(14)7(13)9(15)11(3,4)12(10,5)6/h1-6H3 |
| InChIKey | UHWWMPBFZVNCKH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|