C11H18O2 — CID 14148814
3,3,4,4,5,5-hexamethylcyclopentane-1,2-dione (PubChem CID 14148814) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexamethylcyclopentane-1,2-dione.
| Compound Name | 3,3,4,4,5,5-hexamethylcyclopentane-1,2-dione |
|---|---|
| PubChem CID | 14148814 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3,3,4,4,5,5-hexamethylcyclopentane-1,2-dione |
| SMILES | CC1(C)C(=O)C(=O)C(C)(C)C1(C)C |
| InChI | InChI=1S/C11H18O2/c1-9(2)7(12)8(13)10(3,4)11(9,5)6/h1-6H3 |
| InChIKey | JKRGMLBEJGFLOG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|