C7H12O4 — CID 25205700
2-ethoxy-2-methyl-1,3-dioxan-5-one (PubChem CID 25205700) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-ethoxy-2-methyl-1,3-dioxan-5-one.
| Compound Name | 2-ethoxy-2-methyl-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 25205700 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-ethoxy-2-methyl-1,3-dioxan-5-one |
| SMILES | CCOC1(C)OCC(=O)CO1 |
| InChI | InChI=1S/C7H12O4/c1-3-9-7(2)10-4-6(8)5-11-7/h3-5H2,1-2H3 |
| InChIKey | HPPLHRMFZPDKNK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |