About 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone
1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone (PubChem CID 59637443) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone |
| PubChem CID | 59637443 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone |
| SMILES | [C-]#[N+]C1(C(C)=O)COC(C)(OCC)OC1 |
| InChI | InChI=1S/C10H15NO4/c1-5-13-9(3)14-6-10(11-4,7-15-9)8(2)12/h5-7H2,1-3H3 |
| InChIKey | HVXGUWVBJLWNRH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 49.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone?
The IUPAC name of 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone (CID 59637443) is 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone.
What is the SMILES notation for 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone?
The canonical SMILES for 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone is [C-]#[N+]C1(C(C)=O)COC(C)(OCC)OC1.
What is the InChIKey of 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone?
The InChIKey is HVXGUWVBJLWNRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4/c1-5-13-9(3)14-6-10(11-4,7-15-9)8(2)12/h5-7H2,1-3H3.
What are the key properties of 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone?
1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone has a molecular weight of 213.23 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethoxy-5-isocyano-2-methyl-1,3-dioxan-5-yl)ethanone is sourced from PubChem (CID 59637443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).