C13H24O4 — CID 15181700
ethyl 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)butanoate (PubChem CID 15181700) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is ethyl 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)butanoate.
| Compound Name | ethyl 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)butanoate |
|---|---|
| PubChem CID | 15181700 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | ethyl 2-(2,5,5-trimethyl-1,3-dioxan-2-yl)butanoate |
| SMILES | CCOC(=O)C(CC)C1(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C13H24O4/c1-6-10(11(14)15-7-2)13(5)16-8-12(3,4)9-17-13/h10H,6-9H2,1-5H3 |
| InChIKey | UXSGTXNZTNIQPC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |