C18H28O7S2 — CID 101030366
diethyl 2-[(1R,2S)-2-ethoxycarbothioylsulfanyl-6,6-dimethyl-4,8-dioxaspiro[2.5]octan-1-yl]propanedioate (PubChem CID 101030366) has the molecular formula C18H28O7S2 and a molecular weight of 420.55 g/mol. Its IUPAC name is diethyl 2-[(1R,2S)-2-ethoxycarbothioylsulfanyl-6,6-dimethyl-4,8-dioxaspiro[2.5]octan-1-yl]propanedioate.
| Compound Name | diethyl 2-[(1R,2S)-2-ethoxycarbothioylsulfanyl-6,6-dimethyl-4,8-dioxaspiro[2.5]octan-1-yl]propanedioate |
|---|---|
| PubChem CID | 101030366 |
| Molecular Formula | C18H28O7S2 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | diethyl 2-[(1R,2S)-2-ethoxycarbothioylsulfanyl-6,6-dimethyl-4,8-dioxaspiro[2.5]octan-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H]1[C@H](SC(=S)OCC)C12OCC(C)(C)CO2 |
| InChI | InChI=1S/C18H28O7S2/c1-6-21-14(19)11(15(20)22-7-2)12-13(27-16(26)23-8-3)18(12)24-9-17(4,5)10-25-18/h11-13H,6-10H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | VHYFTZAOVJVMBH-STQMWFEESA-N |
| XLogP | 2.55 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|