C16H26O2S2 — CID 11243949
O-ethyl [(3aR,7aR)-7a-methyl-1-oxo-3-propan-2-yl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]sulfanylmethanethioate (PubChem CID 11243949) has the molecular formula C16H26O2S2 and a molecular weight of 314.52 g/mol. Its IUPAC name is O-ethyl [(3aR,7aR)-7a-methyl-1-oxo-3-propan-2-yl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [(3aR,7aR)-7a-methyl-1-oxo-3-propan-2-yl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 11243949 |
| Molecular Formula | C16H26O2S2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | O-ethyl [(3aR,7aR)-7a-methyl-1-oxo-3-propan-2-yl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC1CCC[C@@]2(C)C(=O)CC(C(C)C)[C@@H]12 |
| InChI | InChI=1S/C16H26O2S2/c1-5-18-15(19)20-12-7-6-8-16(4)13(17)9-11(10(2)3)14(12)16/h10-12,14H,5-9H2,1-4H3/t11?,12?,14-,16-/m0/s1 |
| InChIKey | ASDKYXIGBXFCHD-KAASVAGXSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|