C19H30O3S2 — CID 138977387
O-ethyl (3a,6,6,9a-tetramethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-8-yl)sulfanylmethanethioate (PubChem CID 138977387) has the molecular formula C19H30O3S2 and a molecular weight of 370.58 g/mol. Its IUPAC name is O-ethyl (3a,6,6,9a-tetramethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-8-yl)sulfanylmethanethioate.
| Compound Name | O-ethyl (3a,6,6,9a-tetramethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-8-yl)sulfanylmethanethioate |
|---|---|
| PubChem CID | 138977387 |
| Molecular Formula | C19H30O3S2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | O-ethyl (3a,6,6,9a-tetramethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-8-yl)sulfanylmethanethioate |
| SMILES | CCOC(=S)SC1CC(C)(C)C2CCC3(C)OC(=O)CC3C2(C)C1 |
| InChI | InChI=1S/C19H30O3S2/c1-6-21-16(23)24-12-10-17(2,3)13-7-8-19(5)14(9-15(20)22-19)18(13,4)11-12/h12-14H,6-11H2,1-5H3 |
| InChIKey | ZJRPDAOWXNHDAS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|