C16H25ClO2 — CID 162410007
8-chloro-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one (PubChem CID 162410007) has the molecular formula C16H25ClO2 and a molecular weight of 284.83 g/mol. Its IUPAC name is 8-chloro-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one.
| Compound Name | 8-chloro-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 162410007 |
| Molecular Formula | C16H25ClO2 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 8-chloro-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one |
| SMILES | CC1(C)CC(Cl)CC2(C)C1CCC1(C)OC(=O)CC12 |
| InChI | InChI=1S/C16H25ClO2/c1-14(2)8-10(17)9-15(3)11(14)5-6-16(4)12(15)7-13(18)19-16/h10-12H,5-9H2,1-4H3 |
| InChIKey | IHIHLWAOXALOEI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|