C17H27ClHgO2 — CID 100975621
CID 100975621 (PubChem CID 100975621) has the molecular formula C17H27ClHgO2 and a molecular weight of 499.44 g/mol.
| Compound Name | CID 100975621 |
|---|---|
| PubChem CID | 100975621 |
| Molecular Formula | C17H27ClHgO2 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | — |
| SMILES | CC1(C)[CH]CC[C@@]2(C)C1CC[C@@]1(C)OC(=O)CCC21.[Cl-].[Hg+] |
| InChI | InChI=1S/C17H27O2.ClH.Hg/c1-15(2)9-5-10-16(3)12(15)8-11-17(4)13(16)6-7-14(18)19-17;;/h9,12-13H,5-8,10-11H2,1-4H3;1H;/q;;+1/p-1/t12?,13?,16-,17+;;/m0../s1 |
| InChIKey | HMHPRBODHVVDIK-KEGAZOASSA-M |
| XLogP | 1.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|