C22H30O2 — CID 166130483
(3aR,8S,9aS,9bR)-3a,6,6,9a-tetramethyl-8-phenyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one (PubChem CID 166130483) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (3aR,8S,9aS,9bR)-3a,6,6,9a-tetramethyl-8-phenyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one.
| Compound Name | (3aR,8S,9aS,9bR)-3a,6,6,9a-tetramethyl-8-phenyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 166130483 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (3aR,8S,9aS,9bR)-3a,6,6,9a-tetramethyl-8-phenyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one |
| SMILES | CC1(C)C[C@H](c2ccccc2)C[C@@]2(C)C1CC[C@@]1(C)OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C22H30O2/c1-20(2)13-16(15-8-6-5-7-9-15)14-21(3)17(20)10-11-22(4)18(21)12-19(23)24-22/h5-9,16-18H,10-14H2,1-4H3/t16-,17?,18+,21-,22+/m0/s1 |
| InChIKey | XVLYODPRUAYUIW-YIZHUFRJSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |