C19H18O2 — CID 15259021
(3aR,5R,6aR)-5,6a-diphenyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 15259021) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3aR,5R,6aR)-5,6a-diphenyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3aR,5R,6aR)-5,6a-diphenyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 15259021 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (3aR,5R,6aR)-5,6a-diphenyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@H]2C[C@@H](c3ccccc3)C[C@@]2(c2ccccc2)O1 |
| InChI | InChI=1S/C19H18O2/c20-18-12-17-11-15(14-7-3-1-4-8-14)13-19(17,21-18)16-9-5-2-6-10-16/h1-10,15,17H,11-13H2/t15-,17-,19+/m1/s1 |
| InChIKey | IZITZLLYZURFGB-SUMDDJOVSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |