C16H24 — CID 20692192
(3-ethyl-3,5-dimethylcyclohexyl)benzene (PubChem CID 20692192) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is (3-ethyl-3,5-dimethylcyclohexyl)benzene.
| Compound Name | (3-ethyl-3,5-dimethylcyclohexyl)benzene |
|---|---|
| PubChem CID | 20692192 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | (3-ethyl-3,5-dimethylcyclohexyl)benzene |
| SMILES | CCC1(C)CC(C)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C16H24/c1-4-16(3)11-13(2)10-15(12-16)14-8-6-5-7-9-14/h5-9,13,15H,4,10-12H2,1-3H3 |
| InChIKey | NCIMECMZNMDYKV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |