C16H32 — CID 158662889
1,5-diethyl-1,3,5,7-tetramethylcyclooctane (PubChem CID 158662889) has the molecular formula C16H32 and a molecular weight of 224.43 g/mol. Its IUPAC name is 1,5-diethyl-1,3,5,7-tetramethylcyclooctane.
| Compound Name | 1,5-diethyl-1,3,5,7-tetramethylcyclooctane |
|---|---|
| PubChem CID | 158662889 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | 1,5-diethyl-1,3,5,7-tetramethylcyclooctane |
| SMILES | CCC1(C)CC(C)CC(C)(CC)CC(C)C1 |
| InChI | InChI=1S/C16H32/c1-7-15(5)9-13(3)11-16(6,8-2)12-14(4)10-15/h13-14H,7-12H2,1-6H3 |
| InChIKey | DNFHTGIVBAYARE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |