C11H26 — CID 171820543
1,1-diethyl-3-methylcyclobutane;methane (PubChem CID 171820543) has the molecular formula C11H26 and a molecular weight of 158.33 g/mol. Its IUPAC name is 1,1-diethyl-3-methylcyclobutane;methane.
| Compound Name | 1,1-diethyl-3-methylcyclobutane;methane |
|---|---|
| PubChem CID | 171820543 |
| Molecular Formula | C11H26 |
| Molecular Weight | 158.33 g/mol |
| Exact Mass | 158.20 |
| IUPAC Name | 1,1-diethyl-3-methylcyclobutane;methane |
| SMILES | C.C.CCC1(CC)CC(C)C1 |
| InChI | InChI=1S/C9H18.2CH4/c1-4-9(5-2)6-8(3)7-9;;/h8H,4-7H2,1-3H3;2*1H4 |
| InChIKey | JKZBPGWVJRANMA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |