C13H27N — CID 174352826
N-ethyl-4-(1-ethyl-3-methylcyclobutyl)butan-1-amine (PubChem CID 174352826) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is N-ethyl-4-(1-ethyl-3-methylcyclobutyl)butan-1-amine.
| Compound Name | N-ethyl-4-(1-ethyl-3-methylcyclobutyl)butan-1-amine |
|---|---|
| PubChem CID | 174352826 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-ethyl-4-(1-ethyl-3-methylcyclobutyl)butan-1-amine |
| SMILES | CCNCCCCC1(CC)CC(C)C1 |
| InChI | InChI=1S/C13H27N/c1-4-13(10-12(3)11-13)8-6-7-9-14-5-2/h12,14H,4-11H2,1-3H3 |
| InChIKey | HJMFPCOOMRWJMR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|