C18H39N3 — CID 71166362
N-ethyl-N'-[[2-[(heptylamino)methyl]cyclopropyl]methyl]butane-1,4-diamine (PubChem CID 71166362) has the molecular formula C18H39N3 and a molecular weight of 297.53 g/mol. Its IUPAC name is N-ethyl-N'-[[2-[(heptylamino)methyl]cyclopropyl]methyl]butane-1,4-diamine.
| Compound Name | N-ethyl-N'-[[2-[(heptylamino)methyl]cyclopropyl]methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 71166362 |
| Molecular Formula | C18H39N3 |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.31 |
| IUPAC Name | N-ethyl-N'-[[2-[(heptylamino)methyl]cyclopropyl]methyl]butane-1,4-diamine |
| SMILES | CCCCCCCNCC1CC1CNCCCCNCC |
| InChI | InChI=1S/C18H39N3/c1-3-5-6-7-8-12-20-15-17-14-18(17)16-21-13-10-9-11-19-4-2/h17-21H,3-16H2,1-2H3 |
| InChIKey | ZQSGPADQABXFDF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|