C19H42N4 — CID 145475457
N-methyl-N'-[[(2S)-2-[[4-(pentylamino)butylamino]methyl]cyclopropyl]methyl]butane-1,4-diamine (PubChem CID 145475457) has the molecular formula C19H42N4 and a molecular weight of 326.57 g/mol. Its IUPAC name is N-methyl-N'-[[(2S)-2-[[4-(pentylamino)butylamino]methyl]cyclopropyl]methyl]butane-1,4-diamine.
| Compound Name | N-methyl-N'-[[(2S)-2-[[4-(pentylamino)butylamino]methyl]cyclopropyl]methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 145475457 |
| Molecular Formula | C19H42N4 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.34 |
| IUPAC Name | N-methyl-N'-[[(2S)-2-[[4-(pentylamino)butylamino]methyl]cyclopropyl]methyl]butane-1,4-diamine |
| SMILES | CCCCCNCCCCNC[C@H]1CC1CNCCCCNC |
| InChI | InChI=1S/C19H42N4/c1-3-4-5-11-21-12-8-9-14-23-17-19-15-18(19)16-22-13-7-6-10-20-2/h18-23H,3-17H2,1-2H3/t18?,19-/m1/s1 |
| InChIKey | DZQDUZQXDJFAAW-MUMRKEEXSA-N |
| XLogP | 2.36 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|