C19H46 — CID 171802014
1,3-dimethyl-1-pentylcyclobutane;ethane (PubChem CID 171802014) has the molecular formula C19H46 and a molecular weight of 274.58 g/mol. Its IUPAC name is 1,3-dimethyl-1-pentylcyclobutane;ethane.
| Compound Name | 1,3-dimethyl-1-pentylcyclobutane;ethane |
|---|---|
| PubChem CID | 171802014 |
| Molecular Formula | C19H46 |
| Molecular Weight | 274.58 g/mol |
| Exact Mass | 274.36 |
| IUPAC Name | 1,3-dimethyl-1-pentylcyclobutane;ethane |
| SMILES | CC.CC.CC.CC.CCCCCC1(C)CC(C)C1 |
| InChI | InChI=1S/C11H22.4C2H6/c1-4-5-6-7-11(3)8-10(2)9-11;4*1-2/h10H,4-9H2,1-3H3;4*1-2H3 |
| InChIKey | DECJOZSHIAWOSJ-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.58 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|