C25H24O2 — CID 23238357
(2S,5R)-3a-methyl-2,5,6a-triphenyl-2,3,4,5-tetrahydrofuro[2,3-b]furan (PubChem CID 23238357) has the molecular formula C25H24O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2S,5R)-3a-methyl-2,5,6a-triphenyl-2,3,4,5-tetrahydrofuro[2,3-b]furan.
| Compound Name | (2S,5R)-3a-methyl-2,5,6a-triphenyl-2,3,4,5-tetrahydrofuro[2,3-b]furan |
|---|---|
| PubChem CID | 23238357 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (2S,5R)-3a-methyl-2,5,6a-triphenyl-2,3,4,5-tetrahydrofuro[2,3-b]furan |
| SMILES | CC12C[C@@H](c3ccccc3)OC1(c1ccccc1)O[C@@H](c1ccccc1)C2 |
| InChI | InChI=1S/C25H24O2/c1-24-17-22(19-11-5-2-6-12-19)26-25(24,21-15-9-4-10-16-21)27-23(18-24)20-13-7-3-8-14-20/h2-16,22-23H,17-18H2,1H3/t22-,23+,24?,25? |
| InChIKey | QKRSNGGOCNTJBN-KFULVZMISA-N |
| XLogP | 6.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |