C17H28O2 — CID 123771473
3a,6,6,9,9a-pentamethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one (PubChem CID 123771473) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 3a,6,6,9,9a-pentamethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one.
| Compound Name | 3a,6,6,9,9a-pentamethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 123771473 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 3a,6,6,9,9a-pentamethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one |
| SMILES | CC1CCC(C)(C)C2CCC3(C)OC(=O)CC3C12C |
| InChI | InChI=1S/C17H28O2/c1-11-6-8-15(2,3)12-7-9-16(4)13(17(11,12)5)10-14(18)19-16/h11-13H,6-10H2,1-5H3 |
| InChIKey | RJJKCABDXKCGEG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |