C17H24O5 — CID 98173220
(1R,3R,5S,10R,11R)-5,11,16,16-tetramethyl-2,6,15-trioxatetracyclo[9.5.0.01,3.05,10]hexadecane-7,14-dione (PubChem CID 98173220) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (1R,3R,5S,10R,11R)-5,11,16,16-tetramethyl-2,6,15-trioxatetracyclo[9.5.0.01,3.05,10]hexadecane-7,14-dione.
| Compound Name | (1R,3R,5S,10R,11R)-5,11,16,16-tetramethyl-2,6,15-trioxatetracyclo[9.5.0.01,3.05,10]hexadecane-7,14-dione |
|---|---|
| PubChem CID | 98173220 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (1R,3R,5S,10R,11R)-5,11,16,16-tetramethyl-2,6,15-trioxatetracyclo[9.5.0.01,3.05,10]hexadecane-7,14-dione |
| SMILES | CC1(C)OC(=O)CC[C@]2(C)[C@H]3CCC(=O)O[C@@]3(C)C[C@H]3O[C@]312 |
| InChI | InChI=1S/C17H24O5/c1-14(2)17-11(20-17)9-16(4)10(5-6-12(18)22-16)15(17,3)8-7-13(19)21-14/h10-11H,5-9H2,1-4H3/t10-,11-,15-,16+,17-/m1/s1 |
| InChIKey | HTSGPHPZSYMWBH-LQIFXSKXSA-N |
| XLogP | 2.36 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|