C21H31NO3 — CID 166676358
(4aS,4bR,6aS,10aS,10bR,11S,12aS)-4b-amino-10b-ethynyl-11-hydroxy-10a,12a-dimethyl-3,4,4a,5,6,6a,7,8,9,10,11,12-dodecahydronaphtho[2,1-f]chromen-2-one (PubChem CID 166676358) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is (4aS,4bR,6aS,10aS,10bR,11S,12aS)-4b-amino-10b-ethynyl-11-hydroxy-10a,12a-dimethyl-3,4,4a,5,6,6a,7,8,9,10,11,12-dodecahydronaphtho[2,1-f]chromen-2-one.
| Compound Name | (4aS,4bR,6aS,10aS,10bR,11S,12aS)-4b-amino-10b-ethynyl-11-hydroxy-10a,12a-dimethyl-3,4,4a,5,6,6a,7,8,9,10,11,12-dodecahydronaphtho[2,1-f]chromen-2-one |
|---|---|
| PubChem CID | 166676358 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | (4aS,4bR,6aS,10aS,10bR,11S,12aS)-4b-amino-10b-ethynyl-11-hydroxy-10a,12a-dimethyl-3,4,4a,5,6,6a,7,8,9,10,11,12-dodecahydronaphtho[2,1-f]chromen-2-one |
| SMILES | C#C[C@]12[C@@H](O)C[C@]3(C)OC(=O)CC[C@H]3[C@]1(N)CC[C@@H]1CCCC[C@@]12C |
| InChI | InChI=1S/C21H31NO3/c1-4-20-16(23)13-19(3)15(8-9-17(24)25-19)21(20,22)12-10-14-7-5-6-11-18(14,20)2/h1,14-16,23H,5-13,22H2,2-3H3/t14-,15+,16-,18-,19-,20+,21+/m0/s1 |
| InChIKey | HQMVSTGCZHGRMF-QXPZLNLISA-N |
| XLogP | 2.77 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|