C16H24O3 — CID 158777206
(4aR,8aR)-1-ethynyl-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol;carbon dioxide (PubChem CID 158777206) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (4aR,8aR)-1-ethynyl-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol;carbon dioxide.
| Compound Name | (4aR,8aR)-1-ethynyl-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol;carbon dioxide |
|---|---|
| PubChem CID | 158777206 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (4aR,8aR)-1-ethynyl-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-ol;carbon dioxide |
| SMILES | C#CC1(O)CCC[C@@H]2C(C)(C)CCC[C@]21C.O=C=O |
| InChI | InChI=1S/C15H24O.CO2/c1-5-15(16)11-6-8-12-13(2,3)9-7-10-14(12,15)4;2-1-3/h1,12,16H,6-11H2,2-4H3;/t12-,14-,15?;/m1./s1 |
| InChIKey | IQPOYSDDWHAWJV-KNJWUZLYSA-N |
| XLogP | 2.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|